C17H11Cl2N3O2 — CID 66572971
5,8-dichloro-3-[(4-methoxyphenyl)methoxy]quinoxaline-2-carbonitrile (PubChem CID 66572971) has the molecular formula C17H11Cl2N3O2 and a molecular weight of 360.20 g/mol. Its IUPAC name is 5,8-dichloro-3-[(4-methoxyphenyl)methoxy]quinoxaline-2-carbonitrile.
| Compound Name | 5,8-dichloro-3-[(4-methoxyphenyl)methoxy]quinoxaline-2-carbonitrile |
|---|---|
| PubChem CID | 66572971 |
| Molecular Formula | C17H11Cl2N3O2 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 5,8-dichloro-3-[(4-methoxyphenyl)methoxy]quinoxaline-2-carbonitrile |
| SMILES | COc1ccc(COc2nc3c(Cl)ccc(Cl)c3nc2C#N)cc1 |
| InChI | InChI=1S/C17H11Cl2N3O2/c1-23-11-4-2-10(3-5-11)9-24-17-14(8-20)21-15-12(18)6-7-13(19)16(15)22-17/h2-7H,9H2,1H3 |
| InChIKey | GLMQCTDICJTLEJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |