C16H14Cl2N4O2 — CID 66573079
[5,8-dichloro-3-[(4-methoxyphenyl)methoxy]quinoxalin-2-yl]hydrazine (PubChem CID 66573079) has the molecular formula C16H14Cl2N4O2 and a molecular weight of 365.22 g/mol. Its IUPAC name is [5,8-dichloro-3-[(4-methoxyphenyl)methoxy]quinoxalin-2-yl]hydrazine.
| Compound Name | [5,8-dichloro-3-[(4-methoxyphenyl)methoxy]quinoxalin-2-yl]hydrazine |
|---|---|
| PubChem CID | 66573079 |
| Molecular Formula | C16H14Cl2N4O2 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | [5,8-dichloro-3-[(4-methoxyphenyl)methoxy]quinoxalin-2-yl]hydrazine |
| SMILES | COc1ccc(COc2nc3c(Cl)ccc(Cl)c3nc2NN)cc1 |
| InChI | InChI=1S/C16H14Cl2N4O2/c1-23-10-4-2-9(3-5-10)8-24-16-15(22-19)20-13-11(17)6-7-12(18)14(13)21-16/h2-7H,8,19H2,1H3,(H,20,22) |
| InChIKey | UXKOELGGNRYPCD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|