C16H15ClF3NO — CID 163567720
2-chloro-6-[2-(4-methoxyphenyl)ethyl]-4-methyl-3-(trifluoromethyl)pyridine (PubChem CID 163567720) has the molecular formula C16H15ClF3NO and a molecular weight of 329.75 g/mol. Its IUPAC name is 2-chloro-6-[2-(4-methoxyphenyl)ethyl]-4-methyl-3-(trifluoromethyl)pyridine.
| Compound Name | 2-chloro-6-[2-(4-methoxyphenyl)ethyl]-4-methyl-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 163567720 |
| Molecular Formula | C16H15ClF3NO |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-chloro-6-[2-(4-methoxyphenyl)ethyl]-4-methyl-3-(trifluoromethyl)pyridine |
| SMILES | COc1ccc(CCc2cc(C)c(C(F)(F)F)c(Cl)n2)cc1 |
| InChI | InChI=1S/C16H15ClF3NO/c1-10-9-12(21-15(17)14(10)16(18,19)20)6-3-11-4-7-13(22-2)8-5-11/h4-5,7-9H,3,6H2,1-2H3 |
| InChIKey | MQSOPYSQPDSZEM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|