C14H16OS — CID 70158894
2-[2-(4-methoxyphenyl)ethyl]-4-methylthiophene (PubChem CID 70158894) has the molecular formula C14H16OS and a molecular weight of 232.35 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)ethyl]-4-methylthiophene.
| Compound Name | 2-[2-(4-methoxyphenyl)ethyl]-4-methylthiophene |
|---|---|
| PubChem CID | 70158894 |
| Molecular Formula | C14H16OS |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)ethyl]-4-methylthiophene |
| SMILES | COc1ccc(CCc2cc(C)cs2)cc1 |
| InChI | InChI=1S/C14H16OS/c1-11-9-14(16-10-11)8-5-12-3-6-13(15-2)7-4-12/h3-4,6-7,9-10H,5,8H2,1-2H3 |
| InChIKey | LBLUTGFVMKGLTJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |