C14H14Cl2OS — CID 80530344
3-chloro-2-[1-chloro-3-(4-methoxyphenyl)propyl]thiophene (PubChem CID 80530344) has the molecular formula C14H14Cl2OS and a molecular weight of 301.24 g/mol. Its IUPAC name is 3-chloro-2-[1-chloro-3-(4-methoxyphenyl)propyl]thiophene.
| Compound Name | 3-chloro-2-[1-chloro-3-(4-methoxyphenyl)propyl]thiophene |
|---|---|
| PubChem CID | 80530344 |
| Molecular Formula | C14H14Cl2OS |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 3-chloro-2-[1-chloro-3-(4-methoxyphenyl)propyl]thiophene |
| SMILES | COc1ccc(CCC(Cl)c2sccc2Cl)cc1 |
| InChI | InChI=1S/C14H14Cl2OS/c1-17-11-5-2-10(3-6-11)4-7-12(15)14-13(16)8-9-18-14/h2-3,5-6,8-9,12H,4,7H2,1H3 |
| InChIKey | NPOIOTWSUMAELP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|