C16H18ClNO2S — CID 59820011
N-[2-(4-chlorothiophen-2-yl)ethyl]-3-(4-methoxyphenyl)propanamide (PubChem CID 59820011) has the molecular formula C16H18ClNO2S and a molecular weight of 323.85 g/mol. Its IUPAC name is N-[2-(4-chlorothiophen-2-yl)ethyl]-3-(4-methoxyphenyl)propanamide.
| Compound Name | N-[2-(4-chlorothiophen-2-yl)ethyl]-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 59820011 |
| Molecular Formula | C16H18ClNO2S |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | N-[2-(4-chlorothiophen-2-yl)ethyl]-3-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NCCc2cc(Cl)cs2)cc1 |
| InChI | InChI=1S/C16H18ClNO2S/c1-20-14-5-2-12(3-6-14)4-7-16(19)18-9-8-15-10-13(17)11-21-15/h2-3,5-6,10-11H,4,7-9H2,1H3,(H,18,19) |
| InChIKey | RHFYTWYUFPXTFT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |