C19H14Cl2F2N4 — CID 170793964
2,7-dichloro-3-[4-[(2,4-difluorophenyl)methylidene]piperidin-1-yl]pyrido[3,4-b]pyrazine (PubChem CID 170793964) has the molecular formula C19H14Cl2F2N4 and a molecular weight of 407.25 g/mol. Its IUPAC name is 2,7-dichloro-3-[4-[(2,4-difluorophenyl)methylidene]piperidin-1-yl]pyrido[3,4-b]pyrazine.
| Compound Name | 2,7-dichloro-3-[4-[(2,4-difluorophenyl)methylidene]piperidin-1-yl]pyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 170793964 |
| Molecular Formula | C19H14Cl2F2N4 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 2,7-dichloro-3-[4-[(2,4-difluorophenyl)methylidene]piperidin-1-yl]pyrido[3,4-b]pyrazine |
| SMILES | Fc1ccc(C=C2CCN(c3nc4cnc(Cl)cc4nc3Cl)CC2)c(F)c1 |
| InChI | InChI=1S/C19H14Cl2F2N4/c20-17-9-15-16(10-24-17)26-19(18(21)25-15)27-5-3-11(4-6-27)7-12-1-2-13(22)8-14(12)23/h1-2,7-10H,3-6H2 |
| InChIKey | FYTYAXCPBDQXFT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|