C11H13N5O2 — CID 170796349
ethyl 4-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)but-3-enoate (PubChem CID 170796349) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is ethyl 4-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)but-3-enoate.
| Compound Name | ethyl 4-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)but-3-enoate |
|---|---|
| PubChem CID | 170796349 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | ethyl 4-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)but-3-enoate |
| SMILES | CCOC(=O)CC=Cc1[nH]nc2ncnc(N)c12 |
| InChI | InChI=1S/C11H13N5O2/c1-2-18-8(17)5-3-4-7-9-10(12)13-6-14-11(9)16-15-7/h3-4,6H,2,5H2,1H3,(H3,12,13,14,15,16) |
| InChIKey | QHSCSIUUJTWRDR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |