C10H10F3N3O — CID 170798498
4-[2-amino-5-(trifluoromethyl)-3-pyridinyl]but-3-enamide (PubChem CID 170798498) has the molecular formula C10H10F3N3O and a molecular weight of 245.20 g/mol. Its IUPAC name is 4-[2-amino-5-(trifluoromethyl)-3-pyridinyl]but-3-enamide.
| Compound Name | 4-[2-amino-5-(trifluoromethyl)-3-pyridinyl]but-3-enamide |
|---|---|
| PubChem CID | 170798498 |
| Molecular Formula | C10H10F3N3O |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 4-[2-amino-5-(trifluoromethyl)-3-pyridinyl]but-3-enamide |
| SMILES | NC(=O)CC=Cc1cc(C(F)(F)F)cnc1N |
| InChI | InChI=1S/C10H10F3N3O/c11-10(12,13)7-4-6(9(15)16-5-7)2-1-3-8(14)17/h1-2,4-5H,3H2,(H2,14,17)(H2,15,16) |
| InChIKey | VHIBANQEPHYJDZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |