C12H9NO2 — CID 170799962
4-(2,6-diformylphenyl)but-3-enenitrile (PubChem CID 170799962) has the molecular formula C12H9NO2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 4-(2,6-diformylphenyl)but-3-enenitrile.
| Compound Name | 4-(2,6-diformylphenyl)but-3-enenitrile |
|---|---|
| PubChem CID | 170799962 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 4-(2,6-diformylphenyl)but-3-enenitrile |
| SMILES | N#CCC=Cc1c(C=O)cccc1C=O |
| InChI | InChI=1S/C12H9NO2/c13-7-2-1-6-12-10(8-14)4-3-5-11(12)9-15/h1,3-6,8-9H,2H2 |
| InChIKey | KIYXNLDIUXLODS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|