C14H21BN2O3 — CID 170800897
3-(6-amino-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol (PubChem CID 170800897) has the molecular formula C14H21BN2O3 and a molecular weight of 276.14 g/mol. Its IUPAC name is 3-(6-amino-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol.
| Compound Name | 3-(6-amino-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 170800897 |
| Molecular Formula | C14H21BN2O3 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-(6-amino-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
| SMILES | CC1(C)OB(C(=Cc2cccc(N)n2)CO)OC1(C)C |
| InChI | InChI=1S/C14H21BN2O3/c1-13(2)14(3,4)20-15(19-13)10(9-18)8-11-6-5-7-12(16)17-11/h5-8,18H,9H2,1-4H3,(H2,16,17) |
| InChIKey | PLZLRYNLZZYBJH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 77.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|