C24H25ClN4O5 — CID 17081745
N-(4-chloro-3-nitrophenyl)-1-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]piperidine-4-carboxamide (PubChem CID 17081745) has the molecular formula C24H25ClN4O5 and a molecular weight of 484.94 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-1-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-1-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17081745 |
| Molecular Formula | C24H25ClN4O5 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-1-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(N2CC(C(=O)N3CCC(C(=O)Nc4ccc(Cl)c([N+](=O)[O-])c4)CC3)CC2=O)cc1 |
| InChI | InChI=1S/C24H25ClN4O5/c1-15-2-5-19(6-3-15)28-14-17(12-22(28)30)24(32)27-10-8-16(9-11-27)23(31)26-18-4-7-20(25)21(13-18)29(33)34/h2-7,13,16-17H,8-12,14H2,1H3,(H,26,31) |
| InChIKey | RKCFTSCMGOOOJR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|