C25H25N5O5S — CID 17081834
1-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]-N-(6-nitro-1,3-benzothiazol-2-yl)piperidine-4-carboxamide (PubChem CID 17081834) has the molecular formula C25H25N5O5S and a molecular weight of 507.57 g/mol. Its IUPAC name is 1-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]-N-(6-nitro-1,3-benzothiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]-N-(6-nitro-1,3-benzothiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17081834 |
| Molecular Formula | C25H25N5O5S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 1-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]-N-(6-nitro-1,3-benzothiazol-2-yl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(N2CC(C(=O)N3CCC(C(=O)Nc4nc5ccc([N+](=O)[O-])cc5s4)CC3)CC2=O)cc1 |
| InChI | InChI=1S/C25H25N5O5S/c1-15-2-4-18(5-3-15)29-14-17(12-22(29)31)24(33)28-10-8-16(9-11-28)23(32)27-25-26-20-7-6-19(30(34)35)13-21(20)36-25/h2-7,13,16-17H,8-12,14H2,1H3,(H,26,27,32) |
| InChIKey | NAFKYUVIOUAJCC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 125.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|