C15H14N4O4S — CID 7462526
(3R)-1-(4-methylphenyl)-N-(5-nitro-1,3-thiazol-2-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 7462526) has the molecular formula C15H14N4O4S and a molecular weight of 346.37 g/mol. Its IUPAC name is (3R)-1-(4-methylphenyl)-N-(5-nitro-1,3-thiazol-2-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(4-methylphenyl)-N-(5-nitro-1,3-thiazol-2-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 7462526 |
| Molecular Formula | C15H14N4O4S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | (3R)-1-(4-methylphenyl)-N-(5-nitro-1,3-thiazol-2-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2C[C@H](C(=O)Nc3ncc([N+](=O)[O-])s3)CC2=O)cc1 |
| InChI | InChI=1S/C15H14N4O4S/c1-9-2-4-11(5-3-9)18-8-10(6-12(18)20)14(21)17-15-16-7-13(24-15)19(22)23/h2-5,7,10H,6,8H2,1H3,(H,16,17,21)/t10-/m1/s1 |
| InChIKey | WIVBWTCSGYLKIE-SNVBAGLBSA-N |
| XLogP | 2.35 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|