C11H14N4O4S — CID 9401012
(3S)-N-(5-nitro-1,3-thiazol-2-yl)-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 9401012) has the molecular formula C11H14N4O4S and a molecular weight of 298.32 g/mol. Its IUPAC name is (3S)-N-(5-nitro-1,3-thiazol-2-yl)-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-(5-nitro-1,3-thiazol-2-yl)-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 9401012 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (3S)-N-(5-nitro-1,3-thiazol-2-yl)-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | CC(C)N1C[C@@H](C(=O)Nc2ncc([N+](=O)[O-])s2)CC1=O |
| InChI | InChI=1S/C11H14N4O4S/c1-6(2)14-5-7(3-8(14)16)10(17)13-11-12-4-9(20-11)15(18)19/h4,6-7H,3,5H2,1-2H3,(H,12,13,17)/t7-/m0/s1 |
| InChIKey | WTHAZMZFVJQTQW-ZETCQYMHSA-N |
| XLogP | 1.25 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|