C10H14O4 — CID 170817493
1-(3-hydroxy-5-methylphenyl)propane-1,2,3-triol (PubChem CID 170817493) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-(3-hydroxy-5-methylphenyl)propane-1,2,3-triol.
| Compound Name | 1-(3-hydroxy-5-methylphenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817493 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-(3-hydroxy-5-methylphenyl)propane-1,2,3-triol |
| SMILES | Cc1cc(O)cc(C(O)C(O)CO)c1 |
| InChI | InChI=1S/C10H14O4/c1-6-2-7(4-8(12)3-6)10(14)9(13)5-11/h2-4,9-14H,5H2,1H3 |
| InChIKey | DDZIVBYVPGSLRO-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |