C11H10N2O5 — CID 170824720
2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid (PubChem CID 170824720) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid.
| Compound Name | 2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid |
|---|---|
| PubChem CID | 170824720 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid |
| SMILES | O=C(O)C(O)C(O)c1ccc2nc[nH]c(=O)c2c1 |
| InChI | InChI=1S/C11H10N2O5/c14-8(9(15)11(17)18)5-1-2-7-6(3-5)10(16)13-4-12-7/h1-4,8-9,14-15H,(H,17,18)(H,12,13,16) |
| InChIKey | FSBIJRQOGSTTOZ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |