2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid

C11H10N2O5 — CID 170824720

IUPAC2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid
SMILESO=C(O)C(O)C(O)c1ccc2nc[nH]c(=O)c2c1
InChIInChI=1S/C11H10N2O5/c14-8(9(15)11(17)18)5-1-2-7-6(3-5)10(16)13-4-12-7/h1-4,8-9,14-15H,(H,17,18)(H,12,13,16)
InChIKeyFSBIJRQOGSTTOZ-UHFFFAOYSA-N
MW250.21 g/mol
LogP-0.60
Rot. Bonds3

About 2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid

2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid (PubChem CID 170824720) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid.

Molecular Properties

Compound Name2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid
PubChem CID170824720
Molecular FormulaC11H10N2O5
Molecular Weight250.21 g/mol
Exact Mass250.06
IUPAC Name2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid
SMILESO=C(O)C(O)C(O)c1ccc2nc[nH]c(=O)c2c1
InChIInChI=1S/C11H10N2O5/c14-8(9(15)11(17)18)5-1-2-7-6(3-5)10(16)13-4-12-7/h1-4,8-9,14-15H,(H,17,18)(H,12,13,16)
InChIKeyFSBIJRQOGSTTOZ-UHFFFAOYSA-N
XLogP-0.60
TPSA123.51 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.21
LogP ≤ 5-0.60
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze 2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid?
The IUPAC name of 2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid (CID 170824720) is 2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid.
What is the SMILES notation for 2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid?
The canonical SMILES for 2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid is O=C(O)C(O)C(O)c1ccc2nc[nH]c(=O)c2c1.
What is the InChIKey of 2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid?
The InChIKey is FSBIJRQOGSTTOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O5/c14-8(9(15)11(17)18)5-1-2-7-6(3-5)10(16)13-4-12-7/h1-4,8-9,14-15H,(H,17,18)(H,12,13,16).
What are the key properties of 2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid?
2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid has a molecular weight of 250.21 g/mol, XLogP of -0.60, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-3-(4-oxo-3H-quinazolin-6-yl)propanoic acid is sourced from PubChem (CID 170824720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).