C17H20FN3O4 — CID 175408459
tert-butyl N-[3-fluoro-2-[hydroxy-(4-oxo-3H-quinazolin-6-yl)methyl]prop-2-enyl]carbamate (PubChem CID 175408459) has the molecular formula C17H20FN3O4 and a molecular weight of 349.36 g/mol. Its IUPAC name is tert-butyl N-[3-fluoro-2-[hydroxy-(4-oxo-3H-quinazolin-6-yl)methyl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-fluoro-2-[hydroxy-(4-oxo-3H-quinazolin-6-yl)methyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 175408459 |
| Molecular Formula | C17H20FN3O4 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | tert-butyl N-[3-fluoro-2-[hydroxy-(4-oxo-3H-quinazolin-6-yl)methyl]prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=CF)C(O)c1ccc2nc[nH]c(=O)c2c1 |
| InChI | InChI=1S/C17H20FN3O4/c1-17(2,3)25-16(24)19-8-11(7-18)14(22)10-4-5-13-12(6-10)15(23)21-9-20-13/h4-7,9,14,22H,8H2,1-3H3,(H,19,24)(H,20,21,23) |
| InChIKey | OYYFHFWTEQBKRX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |