C12H18N2O5 — CID 170831399
ethyl 5-(3-acetamido-1,2-dihydroxypropyl)-1H-pyrrole-2-carboxylate (PubChem CID 170831399) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is ethyl 5-(3-acetamido-1,2-dihydroxypropyl)-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 5-(3-acetamido-1,2-dihydroxypropyl)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 170831399 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | ethyl 5-(3-acetamido-1,2-dihydroxypropyl)-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(C(O)C(O)CNC(C)=O)[nH]1 |
| InChI | InChI=1S/C12H18N2O5/c1-3-19-12(18)9-5-4-8(14-9)11(17)10(16)6-13-7(2)15/h4-5,10-11,14,16-17H,3,6H2,1-2H3,(H,13,15) |
| InChIKey | XNLLTOYXQVJMIS-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |