C10H8BrF3O2S — CID 170837283
1-bromo-1-[2-hydroxy-4-(trifluoromethylsulfanyl)phenyl]propan-2-one (PubChem CID 170837283) has the molecular formula C10H8BrF3O2S and a molecular weight of 329.14 g/mol. Its IUPAC name is 1-bromo-1-[2-hydroxy-4-(trifluoromethylsulfanyl)phenyl]propan-2-one.
| Compound Name | 1-bromo-1-[2-hydroxy-4-(trifluoromethylsulfanyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 170837283 |
| Molecular Formula | C10H8BrF3O2S |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 327.94 |
| IUPAC Name | 1-bromo-1-[2-hydroxy-4-(trifluoromethylsulfanyl)phenyl]propan-2-one |
| SMILES | CC(=O)C(Br)c1ccc(SC(F)(F)F)cc1O |
| InChI | InChI=1S/C10H8BrF3O2S/c1-5(15)9(11)7-3-2-6(4-8(7)16)17-10(12,13)14/h2-4,9,16H,1H3 |
| InChIKey | BXNVNWQWKUKIBB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|