C11H7ClF6O2S — CID 166640531
1-chloro-1-[2-(trifluoromethoxy)-4-(trifluoromethylsulfanyl)phenyl]propan-2-one (PubChem CID 166640531) has the molecular formula C11H7ClF6O2S and a molecular weight of 352.68 g/mol. Its IUPAC name is 1-chloro-1-[2-(trifluoromethoxy)-4-(trifluoromethylsulfanyl)phenyl]propan-2-one.
| Compound Name | 1-chloro-1-[2-(trifluoromethoxy)-4-(trifluoromethylsulfanyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 166640531 |
| Molecular Formula | C11H7ClF6O2S |
| Molecular Weight | 352.68 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 1-chloro-1-[2-(trifluoromethoxy)-4-(trifluoromethylsulfanyl)phenyl]propan-2-one |
| SMILES | CC(=O)C(Cl)c1ccc(SC(F)(F)F)cc1OC(F)(F)F |
| InChI | InChI=1S/C11H7ClF6O2S/c1-5(19)9(12)7-3-2-6(21-11(16,17)18)4-8(7)20-10(13,14)15/h2-4,9H,1H3 |
| InChIKey | XLRDDIPEGUPDHT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.68 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|