C23H26N2O3 — CID 170838401
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] (1S)-2-oxido-1-phenyl-3,4-dihydro-1H-isoquinolin-2-ium-2-carboxylate (PubChem CID 170838401) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (1S)-2-oxido-1-phenyl-3,4-dihydro-1H-isoquinolin-2-ium-2-carboxylate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (1S)-2-oxido-1-phenyl-3,4-dihydro-1H-isoquinolin-2-ium-2-carboxylate |
|---|---|
| PubChem CID | 170838401 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (1S)-2-oxido-1-phenyl-3,4-dihydro-1H-isoquinolin-2-ium-2-carboxylate |
| SMILES | O=C(O[C@H]1CN2CCC1CC2)[N+]1([O-])CCc2ccccc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H26N2O3/c26-23(28-21-16-24-13-10-18(21)11-14-24)25(27)15-12-17-6-4-5-9-20(17)22(25)19-7-2-1-3-8-19/h1-9,18,21-22H,10-16H2/t21-,22-,25?/m0/s1 |
| InChIKey | MKBXDEJKLYUOQP-NTETXRHWSA-N |
| XLogP | 3.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|