C15H14Cl2N4O3 — CID 17084072
3-cyclopropyl-N-[2-[(2,5-dichlorobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084072) has the molecular formula C15H14Cl2N4O3 and a molecular weight of 369.21 g/mol. Its IUPAC name is 3-cyclopropyl-N-[2-[(2,5-dichlorobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-cyclopropyl-N-[2-[(2,5-dichlorobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084072 |
| Molecular Formula | C15H14Cl2N4O3 |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 3-cyclopropyl-N-[2-[(2,5-dichlorobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cc(Cl)ccc1Cl)c1nc(C2CC2)no1 |
| InChI | InChI=1S/C15H14Cl2N4O3/c16-9-3-4-11(17)10(7-9)13(22)18-5-6-19-14(23)15-20-12(21-24-15)8-1-2-8/h3-4,7-8H,1-2,5-6H2,(H,18,22)(H,19,23) |
| InChIKey | ZFXLFYGWMCLKGM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|