C23H19FN4O4 — CID 17084301
3-(2-fluorophenyl)-N-[2-[(2-naphthalen-1-yloxyacetyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084301) has the molecular formula C23H19FN4O4 and a molecular weight of 434.43 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-[2-[(2-naphthalen-1-yloxyacetyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(2-fluorophenyl)-N-[2-[(2-naphthalen-1-yloxyacetyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084301 |
| Molecular Formula | C23H19FN4O4 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 3-(2-fluorophenyl)-N-[2-[(2-naphthalen-1-yloxyacetyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(COc1cccc2ccccc12)NCCNC(=O)c1nc(-c2ccccc2F)no1 |
| InChI | InChI=1S/C23H19FN4O4/c24-18-10-4-3-9-17(18)21-27-23(32-28-21)22(30)26-13-12-25-20(29)14-31-19-11-5-7-15-6-1-2-8-16(15)19/h1-11H,12-14H2,(H,25,29)(H,26,30) |
| InChIKey | VMZCYEAGWBYAPF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|