C19H14Cl3FN4O4 — CID 17084298
3-(2-fluorophenyl)-N-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084298) has the molecular formula C19H14Cl3FN4O4 and a molecular weight of 487.70 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(2-fluorophenyl)-N-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084298 |
| Molecular Formula | C19H14Cl3FN4O4 |
| Molecular Weight | 487.70 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | 3-(2-fluorophenyl)-N-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NCCNC(=O)c1nc(-c2ccccc2F)no1 |
| InChI | InChI=1S/C19H14Cl3FN4O4/c20-11-7-13(22)15(8-12(11)21)30-9-16(28)24-5-6-25-18(29)19-26-17(27-31-19)10-3-1-2-4-14(10)23/h1-4,7-8H,5-6,9H2,(H,24,28)(H,25,29) |
| InChIKey | AJLBPCMJLIHPER-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.70 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|