C22H16Cl3F3N6O4 — CID 17084172
N-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]ethyl]-3-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084172) has the molecular formula C22H16Cl3F3N6O4 and a molecular weight of 591.76 g/mol. Its IUPAC name is N-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]ethyl]-3-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]ethyl]-3-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084172 |
| Molecular Formula | C22H16Cl3F3N6O4 |
| Molecular Weight | 591.76 g/mol |
| Exact Mass | 590.03 |
| IUPAC Name | N-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]ethyl]-3-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NCCNC(=O)c1nc(Cn2c(C(F)(F)F)nc3ccccc32)no1 |
| InChI | InChI=1S/C22H16Cl3F3N6O4/c23-11-7-13(25)16(8-12(11)24)37-10-18(35)29-5-6-30-19(36)20-32-17(33-38-20)9-34-15-4-2-1-3-14(15)31-21(34)22(26,27)28/h1-4,7-8H,5-6,9-10H2,(H,29,35)(H,30,36) |
| InChIKey | FRKBSYOMQOCBGZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.76 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|