C21H16ClF3N6O3 — CID 17084134
N-[2-[(4-chlorobenzoyl)amino]ethyl]-3-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084134) has the molecular formula C21H16ClF3N6O3 and a molecular weight of 492.85 g/mol. Its IUPAC name is N-[2-[(4-chlorobenzoyl)amino]ethyl]-3-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[(4-chlorobenzoyl)amino]ethyl]-3-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084134 |
| Molecular Formula | C21H16ClF3N6O3 |
| Molecular Weight | 492.85 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | N-[2-[(4-chlorobenzoyl)amino]ethyl]-3-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCCNC(=O)c1nc(Cn2c(C(F)(F)F)nc3ccccc32)no1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16ClF3N6O3/c22-13-7-5-12(6-8-13)17(32)26-9-10-27-18(33)19-29-16(30-34-19)11-31-15-4-2-1-3-14(15)28-20(31)21(23,24)25/h1-8H,9-11H2,(H,26,32)(H,27,33) |
| InChIKey | VQHURUSZWNCVKQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.85 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|