C22H18F3N7O5 — CID 17084148
N-[2-[[2-(4-nitrophenyl)acetyl]amino]ethyl]-3-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084148) has the molecular formula C22H18F3N7O5 and a molecular weight of 517.42 g/mol. Its IUPAC name is N-[2-[[2-(4-nitrophenyl)acetyl]amino]ethyl]-3-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[[2-(4-nitrophenyl)acetyl]amino]ethyl]-3-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084148 |
| Molecular Formula | C22H18F3N7O5 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | N-[2-[[2-(4-nitrophenyl)acetyl]amino]ethyl]-3-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)NCCNC(=O)c1nc(Cn2c(C(F)(F)F)nc3ccccc32)no1 |
| InChI | InChI=1S/C22H18F3N7O5/c23-22(24,25)21-28-15-3-1-2-4-16(15)31(21)12-17-29-20(37-30-17)19(34)27-10-9-26-18(33)11-13-5-7-14(8-6-13)32(35)36/h1-8H,9-12H2,(H,26,33)(H,27,34) |
| InChIKey | NHSOMCBSYBKXJR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|