About 2-(2-hydroxyethylamino)ethanol;2-hydroxyethyl(2-oxonioethyl)azanium;sulfuric acid
2-(2-hydroxyethylamino)ethanol;2-hydroxyethyl(2-oxonioethyl)azanium;sulfuric acid (PubChem CID 170844006) has the molecular formula C8H26N2O8S+2
and a molecular weight of 310.37 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)ethanol;2-hydroxyethyl(2-oxonioethyl)azanium;sulfuric acid.
Molecular Properties
| Compound Name | 2-(2-hydroxyethylamino)ethanol;2-hydroxyethyl(2-oxonioethyl)azanium;sulfuric acid |
| PubChem CID | 170844006 |
| Molecular Formula | C8H26N2O8S+2 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol;2-hydroxyethyl(2-oxonioethyl)azanium;sulfuric acid |
| SMILES | O=S(=O)(O)O.OCCNCCO.OCC[NH2+]CC[OH2+] |
| InChI | InChI=1S/2C4H11NO2.H2O4S/c2*6-3-1-5-2-4-7;1-5(2,3)4/h2*5-7H,1-4H2;(H2,1,2,3,4)/p+2 |
| InChIKey | KIXITUQQGMENCA-UHFFFAOYSA-P |
| XLogP | -4.83 |
| TPSA | 186.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | -4.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethylamino)ethanol;2-hydroxyethyl(2-oxonioethyl)azanium;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethylamino)ethanol;2-hydroxyethyl(2-oxonioethyl)azanium;sulfuric acid?
The IUPAC name of 2-(2-hydroxyethylamino)ethanol;2-hydroxyethyl(2-oxonioethyl)azanium;sulfuric acid (CID 170844006) is 2-(2-hydroxyethylamino)ethanol;2-hydroxyethyl(2-oxonioethyl)azanium;sulfuric acid.
What is the SMILES notation for 2-(2-hydroxyethylamino)ethanol;2-hydroxyethyl(2-oxonioethyl)azanium;sulfuric acid?
The canonical SMILES for 2-(2-hydroxyethylamino)ethanol;2-hydroxyethyl(2-oxonioethyl)azanium;sulfuric acid is O=S(=O)(O)O.OCCNCCO.OCC[NH2+]CC[OH2+].
What is the InChIKey of 2-(2-hydroxyethylamino)ethanol;2-hydroxyethyl(2-oxonioethyl)azanium;sulfuric acid?
The InChIKey is KIXITUQQGMENCA-UHFFFAOYSA-P. The full InChI is InChI=1S/2C4H11NO2.H2O4S/c2*6-3-1-5-2-4-7;1-5(2,3)4/h2*5-7H,1-4H2;(H2,1,2,3,4)/p+2.
What are the key properties of 2-(2-hydroxyethylamino)ethanol;2-hydroxyethyl(2-oxonioethyl)azanium;sulfuric acid?
2-(2-hydroxyethylamino)ethanol;2-hydroxyethyl(2-oxonioethyl)azanium;sulfuric acid has a molecular weight of 310.37 g/mol, XLogP of -4.83, 8 rotatable bonds, 7 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethylamino)ethanol;2-hydroxyethyl(2-oxonioethyl)azanium;sulfuric acid is sourced from PubChem (CID 170844006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).