C24H21N5O6 — CID 17084446
3-(2-methyl-3-nitrophenyl)-N-[2-[(2-naphthalen-2-yloxyacetyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084446) has the molecular formula C24H21N5O6 and a molecular weight of 475.46 g/mol. Its IUPAC name is 3-(2-methyl-3-nitrophenyl)-N-[2-[(2-naphthalen-2-yloxyacetyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(2-methyl-3-nitrophenyl)-N-[2-[(2-naphthalen-2-yloxyacetyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084446 |
| Molecular Formula | C24H21N5O6 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 3-(2-methyl-3-nitrophenyl)-N-[2-[(2-naphthalen-2-yloxyacetyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1c(-c2noc(C(=O)NCCNC(=O)COc3ccc4ccccc4c3)n2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H21N5O6/c1-15-19(7-4-8-20(15)29(32)33)22-27-24(35-28-22)23(31)26-12-11-25-21(30)14-34-18-10-9-16-5-2-3-6-17(16)13-18/h2-10,13H,11-12,14H2,1H3,(H,25,30)(H,26,31) |
| InChIKey | VMUZYHDZUGXURG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|