C8H11NNaO3S — CID 170845022
CID 170845022 (PubChem CID 170845022) has the molecular formula C8H11NNaO3S and a molecular weight of 224.24 g/mol.
| Compound Name | CID 170845022 |
|---|---|
| PubChem CID | 170845022 |
| Molecular Formula | C8H11NNaO3S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)CCCc1cccnc1.[Na] |
| InChI | InChI=1S/C8H11NO3S.Na/c10-13(11,12)6-2-4-8-3-1-5-9-7-8;/h1,3,5,7H,2,4,6H2,(H,10,11,12); |
| InChIKey | FQUHADMVVYRLPW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|