C16H35N — CID 170849400
N,N,7-trimethyl-2-pentan-2-yloctan-1-amine (PubChem CID 170849400) has the molecular formula C16H35N and a molecular weight of 241.46 g/mol. Its IUPAC name is N,N,7-trimethyl-2-pentan-2-yloctan-1-amine.
| Compound Name | N,N,7-trimethyl-2-pentan-2-yloctan-1-amine |
|---|---|
| PubChem CID | 170849400 |
| Molecular Formula | C16H35N |
| Molecular Weight | 241.46 g/mol |
| Exact Mass | 241.28 |
| IUPAC Name | N,N,7-trimethyl-2-pentan-2-yloctan-1-amine |
| SMILES | CCCC(C)C(CCCCC(C)C)CN(C)C |
| InChI | InChI=1S/C16H35N/c1-7-10-15(4)16(13-17(5)6)12-9-8-11-14(2)3/h14-16H,7-13H2,1-6H3 |
| InChIKey | QIBDVSRPQZTORI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|