About [(1R,4S,5R)-2-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] acetate
[(1R,4S,5R)-2-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] acetate (PubChem CID 170851046) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is [(1R,4S,5R)-2-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] acetate.
Analyze [(1R,4S,5R)-2-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,4S,5R)-2-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] acetate?
The IUPAC name of [(1R,4S,5R)-2-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] acetate (CID 170851046) is [(1R,4S,5R)-2-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] acetate.
What is the SMILES notation for [(1R,4S,5R)-2-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] acetate?
The canonical SMILES for [(1R,4S,5R)-2-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] acetate is CC(=O)O[C@H]1CC(=O)[C@H]2CO[C@@H]1O2.
What is the InChIKey of [(1R,4S,5R)-2-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] acetate?
The InChIKey is WJFXLZAPNXLJNM-XLPZGREQSA-N. The full InChI is InChI=1S/C8H10O5/c1-4(9)12-6-2-5(10)7-3-11-8(6)13-7/h6-8H,2-3H2,1H3/t6-,7+,8+/m0/s1.
What are the key properties of [(1R,4S,5R)-2-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] acetate?
[(1R,4S,5R)-2-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] acetate has a molecular weight of 186.16 g/mol, XLogP of -0.37, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,4S,5R)-2-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] acetate is sourced from PubChem (CID 170851046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).