C14H15NO5 — CID 170851347
(1R,2R,6R,7R,8R)-5-benzyl-7-hydroxy-3,10,11-trioxa-5-azatricyclo[6.2.1.02,6]undecan-4-one (PubChem CID 170851347) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is (1R,2R,6R,7R,8R)-5-benzyl-7-hydroxy-3,10,11-trioxa-5-azatricyclo[6.2.1.02,6]undecan-4-one.
| Compound Name | (1R,2R,6R,7R,8R)-5-benzyl-7-hydroxy-3,10,11-trioxa-5-azatricyclo[6.2.1.02,6]undecan-4-one |
|---|---|
| PubChem CID | 170851347 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (1R,2R,6R,7R,8R)-5-benzyl-7-hydroxy-3,10,11-trioxa-5-azatricyclo[6.2.1.02,6]undecan-4-one |
| SMILES | O=C1O[C@H]2[C@@H]3OC[C@@H](O3)[C@H](O)[C@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C14H15NO5/c16-11-9-7-18-13(19-9)12-10(11)15(14(17)20-12)6-8-4-2-1-3-5-8/h1-5,9-13,16H,6-7H2/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | UMXGUJXTTIAZCQ-UJPOAAIJSA-N |
| XLogP | 0.49 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |