C28H18N2O7 — CID 170852040
4-(4-aminophenoxy)aniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione (PubChem CID 170852040) has the molecular formula C28H18N2O7 and a molecular weight of 494.46 g/mol. Its IUPAC name is 4-(4-aminophenoxy)aniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione.
| Compound Name | 4-(4-aminophenoxy)aniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 170852040 |
| Molecular Formula | C28H18N2O7 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 4-(4-aminophenoxy)aniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione |
| SMILES | Nc1ccc(Oc2ccc(N)cc2)cc1.O=C1OC(=O)c2cc(-c3ccc4c(c3)C(=O)OC4=O)ccc21 |
| InChI | InChI=1S/C16H6O6.C12H12N2O/c17-13-9-3-1-7(5-11(9)15(19)21-13)8-2-4-10-12(6-8)16(20)22-14(10)18;13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-6H;1-8H,13-14H2 |
| InChIKey | IZWCFDYVGDKSGM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 148.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|