C23H46O11Si3 — CID 170852378
trimethoxy(methyl)silane;trimethoxy(phenyl)silane;3-trimethoxysilylpropyl 2-methylprop-2-enoate (PubChem CID 170852378) has the molecular formula C23H46O11Si3 and a molecular weight of 582.87 g/mol. Its IUPAC name is trimethoxy(methyl)silane;trimethoxy(phenyl)silane;3-trimethoxysilylpropyl 2-methylprop-2-enoate.
| Compound Name | trimethoxy(methyl)silane;trimethoxy(phenyl)silane;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170852378 |
| Molecular Formula | C23H46O11Si3 |
| Molecular Weight | 582.87 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | trimethoxy(methyl)silane;trimethoxy(phenyl)silane;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](OC)(OC)OC.CO[Si](C)(OC)OC.CO[Si](OC)(OC)c1ccccc1 |
| InChI | InChI=1S/C10H20O5Si.C9H14O3Si.C4H12O3Si/c1-9(2)10(11)15-7-6-8-16(12-3,13-4)14-5;1-10-13(11-2,12-3)9-7-5-4-6-8-9;1-5-8(4,6-2)7-3/h1,6-8H2,2-5H3;4-8H,1-3H3;1-4H3 |
| InChIKey | ABMOJSOPYAJKAN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.87 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|