C21H30O5 — CID 170852412
oxiran-2-ylmethyl 2-methylprop-2-enoate;8-tricyclo[5.2.1.02,6]decanyl 2-methylprop-2-enoate (PubChem CID 170852412) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-methylprop-2-enoate;8-tricyclo[5.2.1.02,6]decanyl 2-methylprop-2-enoate.
| Compound Name | oxiran-2-ylmethyl 2-methylprop-2-enoate;8-tricyclo[5.2.1.02,6]decanyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170852412 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | oxiran-2-ylmethyl 2-methylprop-2-enoate;8-tricyclo[5.2.1.02,6]decanyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CC1C1CCCC21.C=C(C)C(=O)OCC1CO1 |
| InChI | InChI=1S/C14H20O2.C7H10O3/c1-8(2)14(15)16-13-7-9-6-12(13)11-5-3-4-10(9)11;1-5(2)7(8)10-4-6-3-9-6/h9-13H,1,3-7H2,2H3;6H,1,3-4H2,2H3 |
| InChIKey | BGVAMPUYDUAPOT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|