C18H26O4 — CID 158839944
2-methylprop-2-enoic acid;8-tricyclo[5.2.1.02,6]decanyl 2-methylprop-2-enoate (PubChem CID 158839944) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;8-tricyclo[5.2.1.02,6]decanyl 2-methylprop-2-enoate.
| Compound Name | 2-methylprop-2-enoic acid;8-tricyclo[5.2.1.02,6]decanyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158839944 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-methylprop-2-enoic acid;8-tricyclo[5.2.1.02,6]decanyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C14H20O2.C4H6O2/c1-8(2)14(15)16-13-7-9-6-12(13)11-5-3-4-10(9)11;1-3(2)4(5)6/h9-13H,1,3-7H2,2H3;1H2,2H3,(H,5,6) |
| InChIKey | IYCNPIRKZJYLBN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|