C22H39F13O7Si2 — CID 170853074
tetraethyl silicate;triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane (PubChem CID 170853074) has the molecular formula C22H39F13O7Si2 and a molecular weight of 718.69 g/mol. Its IUPAC name is tetraethyl silicate;triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane.
| Compound Name | tetraethyl silicate;triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
|---|---|
| PubChem CID | 170853074 |
| Molecular Formula | C22H39F13O7Si2 |
| Molecular Weight | 718.69 g/mol |
| Exact Mass | 718.20 |
| IUPAC Name | tetraethyl silicate;triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
| SMILES | CCO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OCC)OCC.CCO[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C14H19F13O3Si.C8H20O4Si/c1-4-28-31(29-5-2,30-6-3)8-7-9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27;1-5-9-13(10-6-2,11-7-3)12-8-4/h4-8H2,1-3H3;5-8H2,1-4H3 |
| InChIKey | JSBGMGIUVTXMPL-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.69 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|