C18H12N4Na2O8S2 — CID 170853658
disodium;3-[[4-hydroxy-2-oxido-5-[(3-sulfophenyl)diazenyl]phenyl]diazenyl]benzenesulfonate (PubChem CID 170853658) has the molecular formula C18H12N4Na2O8S2 and a molecular weight of 522.43 g/mol. Its IUPAC name is disodium;3-[[4-hydroxy-2-oxido-5-[(3-sulfophenyl)diazenyl]phenyl]diazenyl]benzenesulfonate.
| Compound Name | disodium;3-[[4-hydroxy-2-oxido-5-[(3-sulfophenyl)diazenyl]phenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 170853658 |
| Molecular Formula | C18H12N4Na2O8S2 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 521.99 |
| IUPAC Name | disodium;3-[[4-hydroxy-2-oxido-5-[(3-sulfophenyl)diazenyl]phenyl]diazenyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1cccc(/N=N/c2cc(/N=N/c3cccc(S(=O)(=O)O)c3)c(O)cc2[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C18H14N4O8S2.2Na/c23-17-10-18(24)16(22-20-12-4-2-6-14(8-12)32(28,29)30)9-15(17)21-19-11-3-1-5-13(7-11)31(25,26)27;;/h1-10,23-24H,(H,25,26,27)(H,28,29,30);;/q;2*+1/p-2/b21-19+,22-20+;; |
| InChIKey | ROCXWHFNRMIAKN-JXYRNBIZSA-L |
| XLogP | -2.54 |
| TPSA | 204.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|