C18H37N3Na2O6S — CID 170853916
CID 170853916 (PubChem CID 170853916) has the molecular formula C18H37N3Na2O6S and a molecular weight of 469.56 g/mol.
| Compound Name | CID 170853916 |
|---|---|
| PubChem CID | 170853916 |
| Molecular Formula | C18H37N3Na2O6S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCCNCCNCCNC(=O)CC(C(=O)O)S(=O)(=O)O.[Na].[Na] |
| InChI | InChI=1S/C18H37N3O6S.2Na/c1-2-3-4-5-6-7-8-9-10-19-11-12-20-13-14-21-17(22)15-16(18(23)24)28(25,26)27;;/h16,19-20H,2-15H2,1H3,(H,21,22)(H,23,24)(H,25,26,27);; |
| InChIKey | OWCJITKOXZGSKL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|