C22H41NNa2O6S — CID 170845356
CID 170845356 (PubChem CID 170845356) has the molecular formula C22H41NNa2O6S and a molecular weight of 493.62 g/mol.
| Compound Name | CID 170845356 |
|---|---|
| PubChem CID | 170845356 |
| Molecular Formula | C22H41NNa2O6S |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | — |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNC(=O)CC(C(=O)O)S(=O)(=O)O.[Na].[Na] |
| InChI | InChI=1S/C22H41NO6S.2Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-21(24)19-20(22(25)26)30(27,28)29;;/h9-10,20H,2-8,11-19H2,1H3,(H,23,24)(H,25,26)(H,27,28,29);;/b10-9-;; |
| InChIKey | SPMWUBFFVJFOSR-XXAVUKJNSA-N |
| XLogP | 4.11 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|