C22H41NO6S — CID 20846321
4-[[(Z)-octadec-9-enyl]amino]-4-oxo-3-sulfobutanoic acid (PubChem CID 20846321) has the molecular formula C22H41NO6S and a molecular weight of 447.64 g/mol. Its IUPAC name is 4-[[(Z)-octadec-9-enyl]amino]-4-oxo-3-sulfobutanoic acid.
| Compound Name | 4-[[(Z)-octadec-9-enyl]amino]-4-oxo-3-sulfobutanoic acid |
|---|---|
| PubChem CID | 20846321 |
| Molecular Formula | C22H41NO6S |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 4-[[(Z)-octadec-9-enyl]amino]-4-oxo-3-sulfobutanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNC(=O)C(CC(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C22H41NO6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-22(26)20(19-21(24)25)30(27,28)29/h9-10,20H,2-8,11-19H2,1H3,(H,23,26)(H,24,25)(H,27,28,29)/b10-9- |
| InChIKey | RRIHBWXTKLECIF-KTKRTIGZSA-N |
| XLogP | 4.87 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|