C25H45NNa2O8S — CID 170840043
CID 170840043 (PubChem CID 170840043) has the molecular formula C25H45NNa2O8S and a molecular weight of 565.68 g/mol.
| Compound Name | CID 170840043 |
|---|---|
| PubChem CID | 170840043 |
| Molecular Formula | C25H45NNa2O8S |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | — |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCC(C)OC(=O)CC(C(=O)O)S(=O)(=O)O.[Na].[Na] |
| InChI | InChI=1S/C25H45NO8S.2Na/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(27)26-20-21(2)34-24(28)19-22(25(29)30)35(31,32)33;;/h10-11,21-22H,3-9,12-20H2,1-2H3,(H,26,27)(H,29,30)(H,31,32,33);; |
| InChIKey | GDMFOJQTSMLQJL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|