C14H16N6O2 — CID 17085484
4-[5-(4-butoxyphenyl)triazol-1-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 17085484) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 4-[5-(4-butoxyphenyl)triazol-1-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[5-(4-butoxyphenyl)triazol-1-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 17085484 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-[5-(4-butoxyphenyl)triazol-1-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | CCCCOc1ccc(-c2cnnn2-c2nonc2N)cc1 |
| InChI | InChI=1S/C14H16N6O2/c1-2-3-8-21-11-6-4-10(5-7-11)12-9-16-19-20(12)14-13(15)17-22-18-14/h4-7,9H,2-3,8H2,1H3,(H2,15,17) |
| InChIKey | TXEKBLYHZOVOQT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|