C20H19F2N3O5 — CID 170855321
N-[(2,4-difluorophenyl)methyl]-9-hydroxy-2-(4-hydroxybutyl)-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxamide (PubChem CID 170855321) has the molecular formula C20H19F2N3O5 and a molecular weight of 419.38 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-9-hydroxy-2-(4-hydroxybutyl)-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-9-hydroxy-2-(4-hydroxybutyl)-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 170855321 |
| Molecular Formula | C20H19F2N3O5 |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-9-hydroxy-2-(4-hydroxybutyl)-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1cn2ccn(CCCCO)c(=O)c2c(O)c1=O |
| InChI | InChI=1S/C20H19F2N3O5/c21-13-4-3-12(15(22)9-13)10-23-19(29)14-11-25-7-6-24(5-1-2-8-26)20(30)16(25)18(28)17(14)27/h3-4,6-7,9,11,26,28H,1-2,5,8,10H2,(H,23,29) |
| InChIKey | LUGHESVTXDAPER-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|