C20H19F2N3O6 — CID 171850333
N-[(2,4-difluorophenyl)methyl]-2-(2,2-dimethoxyethyl)-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxamide (PubChem CID 171850333) has the molecular formula C20H19F2N3O6 and a molecular weight of 435.38 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-2-(2,2-dimethoxyethyl)-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-2-(2,2-dimethoxyethyl)-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 171850333 |
| Molecular Formula | C20H19F2N3O6 |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-2-(2,2-dimethoxyethyl)-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxamide |
| SMILES | COC(Cn1ccn2cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(O)c2c1=O)OC |
| InChI | InChI=1S/C20H19F2N3O6/c1-30-15(31-2)10-25-6-5-24-9-13(17(26)18(27)16(24)20(25)29)19(28)23-8-11-3-4-12(21)7-14(11)22/h3-7,9,15,27H,8,10H2,1-2H3,(H,23,28) |
| InChIKey | HQZZMMITIBHVQL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|