C18H20Cl2N2O2 — CID 170855414
7,8-dichloro-N-cyclooctyl-4-oxo-1H-quinoline-2-carboxamide (PubChem CID 170855414) has the molecular formula C18H20Cl2N2O2 and a molecular weight of 367.28 g/mol. Its IUPAC name is 7,8-dichloro-N-cyclooctyl-4-oxo-1H-quinoline-2-carboxamide.
| Compound Name | 7,8-dichloro-N-cyclooctyl-4-oxo-1H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 170855414 |
| Molecular Formula | C18H20Cl2N2O2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 7,8-dichloro-N-cyclooctyl-4-oxo-1H-quinoline-2-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)c1cc(=O)c2ccc(Cl)c(Cl)c2[nH]1 |
| InChI | InChI=1S/C18H20Cl2N2O2/c19-13-9-8-12-15(23)10-14(22-17(12)16(13)20)18(24)21-11-6-4-2-1-3-5-7-11/h8-11H,1-7H2,(H,21,24)(H,22,23) |
| InChIKey | PMYSJQWYJBTJOR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |