C16H9ClF6N2 — CID 170855645
3-[3,5-bis(trifluoromethyl)phenyl]-6-chloro-1-methylpyrrolo[2,3-b]pyridine (PubChem CID 170855645) has the molecular formula C16H9ClF6N2 and a molecular weight of 378.70 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-6-chloro-1-methylpyrrolo[2,3-b]pyridine.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-6-chloro-1-methylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 170855645 |
| Molecular Formula | C16H9ClF6N2 |
| Molecular Weight | 378.70 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-6-chloro-1-methylpyrrolo[2,3-b]pyridine |
| SMILES | Cn1cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccc(Cl)nc21 |
| InChI | InChI=1S/C16H9ClF6N2/c1-25-7-12(11-2-3-13(17)24-14(11)25)8-4-9(15(18,19)20)6-10(5-8)16(21,22)23/h2-7H,1H3 |
| InChIKey | IEEDXMVAZTVWKC-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.70 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|