C19H21F3N6OS — CID 170856273
N-[(Z)-[amino-[6-[[3-(trifluoromethyl)phenyl]methoxy]pyrazin-2-yl]methylidene]amino]piperidine-1-carbothioamide (PubChem CID 170856273) has the molecular formula C19H21F3N6OS and a molecular weight of 438.48 g/mol. Its IUPAC name is N-[(Z)-[amino-[6-[[3-(trifluoromethyl)phenyl]methoxy]pyrazin-2-yl]methylidene]amino]piperidine-1-carbothioamide.
| Compound Name | N-[(Z)-[amino-[6-[[3-(trifluoromethyl)phenyl]methoxy]pyrazin-2-yl]methylidene]amino]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 170856273 |
| Molecular Formula | C19H21F3N6OS |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-[(Z)-[amino-[6-[[3-(trifluoromethyl)phenyl]methoxy]pyrazin-2-yl]methylidene]amino]piperidine-1-carbothioamide |
| SMILES | N/C(=N\NC(=S)N1CCCCC1)c1cncc(OCc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C19H21F3N6OS/c20-19(21,22)14-6-4-5-13(9-14)12-29-16-11-24-10-15(25-16)17(23)26-27-18(30)28-7-2-1-3-8-28/h4-6,9-11H,1-3,7-8,12H2,(H2,23,26)(H,27,30) |
| InChIKey | IVWJFFQNZSIBDU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|